Skip to main content
ExamExplained
NSW · Maths Advanced
Maths Advanced study scene
§-Syllabus dot point
NSWMaths AdvancedSyllabus dot point

How do arithmetic sequences and series model quantities that grow by a fixed amount each period, such as simple interest, salary rises and straight-line depreciation?

Use the formulas for the nth term and the sum of n terms of an arithmetic sequence in financial and modelling contexts

A focused answer to the HSC Maths Advanced dot point on arithmetic sequences and series. The common difference, the nth term, and the two partial-sum formulas, applied to simple interest, salary increments, fixed depreciation and stacked schedules, with worked examples.

Reviewed by: AI editorial process; not yet individually human-reviewed

Have a quick question? Jump to the Q&A page

What this dot point is asking

NESA wants you to recognise arithmetic sequences and series, apply the formula for the nnth term Tn=a+(n1)dT_n = a + (n - 1)d and the two partial-sum formulas, and use them in financial and modelling contexts such as simple interest, salary increments, straight-line depreciation and stacked schedules.

The answer

An arithmetic sequence is what you get whenever a quantity changes by the same fixed amount each period. The moment the change is a constant number of dollars, degrees or units, a fixed simple-interest payment, an equal annual pay rise, a fixed depreciation charge, you have an arithmetic sequence, and its running total is an arithmetic series. This is the constant-difference cousin of the geometric (constant-ratio) sequences that drive compound interest. The whole topic reduces to two ideas: the nnth term Tn=a+(n1)dT_n = a + (n - 1)d, and the sum of the first nn terms, which has two equivalent forms.

Arithmetic sequences

An arithmetic sequence has a constant common difference dd between consecutive terms. With first term aa,

Tn=a+(n1)d.T_n = a + (n - 1)d.

So T1=aT_1 = a, T2=a+dT_2 = a + d, T3=a+2dT_3 = a + 2d, and so on: you add dd exactly n1n - 1 times to reach the nnth term. The defining test is that subtracting any term from the next always gives the same number dd (compare a geometric sequence, where you divide to get a constant ratio). Because each term rises by the same step, the terms plotted against their position sit on a straight line of gradient dd.

An arithmetic sequence as equally spaced points on a straight lineThe terms of the arithmetic sequence 3, 5, 7, 9, 11 plotted against their position n from 1 to 5. The points lie on a straight line rising by the common difference d equals 2 for each step of one in n, with the step marked between the third and fourth points.n (position)T12345357911d = 2Equal steps in n give equal rises d: the points sit on a straight line of gradient d.

Arithmetic series (partial sum)

The sum of the first nn terms is

Sn=n2(2a+(n1)d).S_n = \frac{n}{2}\big(2a + (n - 1)d\big).

There is an equivalent form that uses the last term l=Tnl = T_n instead of dd:

Sn=n2(a+l).S_n = \frac{n}{2}(a + l).

The two are the same formula: substituting l=a+(n1)dl = a + (n - 1)d into the second gives n2(a+a+(n1)d)=n2(2a+(n1)d)\frac{n}{2}(a + a + (n - 1)d) = \frac{n}{2}(2a + (n - 1)d). Use the first when you know aa and dd; use the n2(a+l)\frac{n}{2}(a + l) form when you already know (or can quickly find) both ends, because averaging the two ends and multiplying by the number of terms is faster and less error-prone.

Why the sum formula works

The n2(a+l)\frac{n}{2}(a + l) form is the famous pairing trick. Write the sum forwards and backwards and add:

Sn=a+(a+d)++(ld)+lSn=l+(ld)++(a+d)+a.\begin{aligned} S_n &= a + (a + d) + \cdots + (l - d) + l \\ S_n &= l + (l - d) + \cdots + (a + d) + a. \end{aligned}

Each vertical pair adds to a+la + l, and there are nn pairs, so 2Sn=n(a+l)2 S_n = n(a + l), giving Sn=n2(a+l)S_n = \frac{n}{2}(a + l). The following build-up shows the partial sum growing one term at a time for the sequence 3,5,7,9,113, 5, 7, 9, 11.

Partial sum of an arithmetic series built up term by termFive columns for the running totals of the arithmetic series 3 plus 5 plus 7 plus 9 plus 11. Each column is taller than the last by the next term of the sequence, so the heights are the partial sums 3, 8, 15, 24 and 35, showing the sum growing by an increasing step each time.n (terms summed)S3815243512345+9+11Each new bar adds the next term; the top slice (lighter) is the term just added.

Simple interest as an arithmetic sequence

Simple interest is charged only on the original principal PP, so each period adds the same fixed amount I=PrI = P r (with rr the per-period rate as a decimal). The totals P+Pr,P+2Pr,P+3Pr,P + Pr, P + 2Pr, P + 3Pr, \dots form an arithmetic sequence with common difference PrPr. The amount after nn periods is

An=P(1+rn),A_n = P(1 + rn),

a straight line in nn. This is exactly what separates simple interest (constant difference, arithmetic) from compound interest (constant ratio, geometric).

Straight-line depreciation

An asset that loses a fixed dollar amount DD each year (the "prime cost" or straight-line method) has values V0,V0D,V02D,V_0, V_0 - D, V_0 - 2D, \dots, an arithmetic sequence with common difference D-D. The value after nn years is Vn=V0DnV_n = V_0 - Dn. Contrast this with declining-balance depreciation, which loses a fixed percentage each year and is therefore geometric.

Salary increments and equal instalments

A salary that rises by the same dollar amount each year, an allowance topped up by a fixed sum each period, or a repayment plan that steps up (or down) by an equal amount are all arithmetic. To find a total earned or paid over nn periods, use the partial sum SnS_n; to find the amount in a particular period, use TnT_n.

How exam questions ask about arithmetic sequences and series

The context is dressed up, but each version reduces to identifying aa and dd and choosing TnT_n or SnS_n:

  • "Find the value after nn years" of an asset losing a fixed dollar amount each year. Straight-line depreciation: Vn=V0DnV_n = V_0 - Dn, an arithmetic sequence with difference D-D.
  • "Find the nnth term" or "which term equals XX?" Use Tn=a+(n1)dT_n = a + (n - 1)d; for "which term", set it equal to XX and solve the linear equation for nn.
  • "Find the sum of the first nn terms" or a total of stepped payments. Partial sum Sn=n2(2a+(n1)d)S_n = \dfrac{n}{2}(2a + (n - 1)d), or n2(a+l)\dfrac{n}{2}(a + l) if both ends are known.
  • "Show that the totals form an arithmetic sequence." Subtract consecutive values to show the difference is constant, then state aa and dd; markers want the constant difference demonstrated, not assumed.
  • "How many terms until the total reaches XX?" Set Sn=XS_n = X, form a quadratic in nn, solve and round to the sensible whole number of terms with a check.

Practice questions

Original practice questions graded from foundation to exam level, each with a full worked solution. Try them before revealing the solution.

foundation2 marksFor the arithmetic sequence 7,11,15,19,7, 11, 15, 19, \dots find T20T_{20}.
Show worked solution →

Identify the first term and common difference. Subtracting consecutive terms, 117=411 - 7 = 4, so a=7a = 7 and d=4d = 4.

Apply the nnth-term formula.

T20=a+(n1)d=7+(201)(4)=7+19×4=7+76=83.T_{20} = a + (n - 1)d = 7 + (20 - 1)(4) = 7 + 19 \times 4 = 7 + 76 = 83.

Marker's note: one mark for identifying a=7a = 7 and d=4d = 4, one for T20=83T_{20} = 83 from the correct formula. Using (n)d=20×4(n)d = 20 \times 4 instead of (n1)d=19×4(n - 1)d = 19 \times 4 is the usual off-by-one slip.

foundation2 marksFind the sum of the first 3030 terms of the arithmetic series 2+5+8+11+2 + 5 + 8 + 11 + \cdots
Show worked solution →

Read off aa and dd. The first term is a=2a = 2 and d=52=3d = 5 - 2 = 3.

Apply the partial-sum formula.

S30=n2(2a+(n1)d)=302(2(2)+(301)(3))=15(4+87)=15×91=1365.S_{30} = \frac{n}{2}\big(2a + (n - 1)d\big) = \frac{30}{2}\big(2(2) + (30 - 1)(3)\big) = 15\big(4 + 87\big) = 15 \times 91 = 1365.

Marker's note: one mark for the correct substitution into Sn=n2(2a+(n1)d)S_n = \frac{n}{2}(2a + (n - 1)d), one for S30=1365S_{30} = 1365. Forgetting the outer factor n2\frac{n}{2} is the standard error.

foundation3 marksA machine bought for $24000 is depreciated by the straight-line method at a fixed $1800 per year. (a) Write a formula for its value VnV_n after nn years. (b) Find its value after 66 years.
Show worked solution →

Part (a): recognise a fixed yearly drop as an arithmetic sequence. The value starts at $24000 and falls by the same $1800 each year, so the common difference is d=1800d = -1800. Taking the purchase value as the term at n=0n = 0,

Vn=240001800n.V_n = 24000 - 1800n.

Part (b): substitute n=6n = 6.

V6=240001800(6)=2400010800=13200.V_6 = 24000 - 1800(6) = 24000 - 10800 = 13200.

So the machine is worth $13200 after 66 years.

Marker's note: one mark for the difference d=1800d = -1800 (a subtraction, not a percentage), one for a correct linear formula, one for V6=13200V_6 = 13200. Multiplying by a rate rather than subtracting a fixed amount confuses straight-line with declining-balance depreciation.

core3 marksA principal of $5000 earns simple interest at 6%6\% per annum. Let AnA_n be the total amount (principal plus interest) after nn years. (a) Show that the yearly totals form an arithmetic sequence and state aa and dd. (b) Find the total after 1212 years.
Show worked solution →

Part (a): compute the yearly interest. Simple interest pays a fixed 6%6\% of the original principal each year:

I=5000×0.06=300 per year.I = 5000 \times 0.06 = 300 \text{ per year}.

The totals are $5300, $5600, $5900, and so on: each year adds the same $300, so the totals form an arithmetic sequence. Taking the total after 11 year as the first term, a=5300a = 5300 and d=300d = 300.

Part (b): find the total after 1212 years using An=P(1+rn)A_n = P(1 + rn). The simple-interest amount is

A12=5000(1+0.06×12)=5000(1+0.72)=5000×1.72=8600.A_{12} = 5000\big(1 + 0.06 \times 12\big) = 5000(1 + 0.72) = 5000 \times 1.72 = 8600.

So the total after 1212 years is $8600.

Marker's note: one mark for the constant yearly interest $300 (fixed, because simple interest is charged on the original principal only), one for stating aa and dd, one for A12=8600A_{12} = 8600. Treating the interest as compounding (a constant ratio rather than a constant difference) is the trap.

core4 marksA graduate scheme lists a salary schedule in a table. Year 1 pays 62000, Year 2 pays 65200, Year 3 pays 68400 and Year 4 pays 71600 (all in dollars). (a) Show that the salaries form an arithmetic sequence and state the annual rise. (b) Find the salary in Year 10. (c) Find the total earned over the first 10 years.
Show worked solution →

Part (a): test for a constant difference. Subtract consecutive salaries:

6520062000=3200,6840065200=3200,7160068400=3200.65200 - 62000 = 3200, \qquad 68400 - 65200 = 3200, \qquad 71600 - 68400 = 3200.

The difference is constant at $3200, so the salaries form an arithmetic sequence with a=62000a = 62000 and d=3200d = 3200.

Part (b): the Year 10 salary is T10T_{10}.

T10=a+(n1)d=62000+(101)(3200)=62000+9×3200=62000+28800=90800.T_{10} = a + (n - 1)d = 62000 + (10 - 1)(3200) = 62000 + 9 \times 3200 = 62000 + 28800 = 90800.

Part (c): the total earned is S10S_{10}. Using the last-term form with l=T10=90800l = T_{10} = 90800,

S10=n2(a+l)=102(62000+90800)=5×152800=764000.S_{10} = \frac{n}{2}(a + l) = \frac{10}{2}(62000 + 90800) = 5 \times 152800 = 764000.

So the salary in Year 10 is $90800 and the ten-year total is $764000.

Marker's note: one mark for showing the constant difference $3200, one for T10=90800T_{10} = 90800, one for the correct sum method, one for the total $764000. Using 99 terms instead of 1010, or the rise as a percentage, are the common slips.

core3 marksThe sum of the first nn terms of an arithmetic series is Sn=100S_n = 100 for the series 4+7+10+4 + 7 + 10 + \cdots. Find nn.
Show worked solution →

Set up SnS_n with a=4a = 4 and d=3d = 3.

Sn=n2(2a+(n1)d)=n2(8+3(n1))=n2(3n+5).S_n = \frac{n}{2}\big(2a + (n - 1)d\big) = \frac{n}{2}\big(8 + 3(n - 1)\big) = \frac{n}{2}(3n + 5).

Solve Sn=100S_n = 100.

n2(3n+5)=100n(3n+5)=2003n2+5n200=0.\frac{n}{2}(3n + 5) = 100 \quad\Rightarrow\quad n(3n + 5) = 200 \quad\Rightarrow\quad 3n^2 + 5n - 200 = 0.

Use the quadratic formula.

n=5±25+24006=5±24256=5±49.2446.n = \frac{-5 \pm \sqrt{25 + 2400}}{6} = \frac{-5 \pm \sqrt{2425}}{6} = \frac{-5 \pm 49.244\ldots}{6}.

The positive root is n=44.24467.37n = \dfrac{44.244\ldots}{6} \approx 7.37. Since nn must be a whole number of terms and S7=91S_7 = 91 while S8=116S_8 = 116, no whole nn gives exactly 100100; the first total to reach or exceed 100100 is at n=8n = 8.

Marker's note: one mark for the quadratic 3n2+5n200=03n^2 + 5n - 200 = 0, one for solving it, one for interpreting the non-integer root sensibly (checking S7S_7 and S8S_8 rather than quoting a fractional number of terms). Accepting n7.37n \approx 7.37 as a final answer ignores that nn counts terms.

exam5 marksEach month Mia adds $50 more to her repayment than the month before, starting with $200 in month 1. (a) Show that her monthly repayments form an arithmetic sequence and write the amount paid in month nn. (b) Find the total repaid after 24 months. (c) The loan plus interest totals $30000. In which month does the running total first reach or exceed $30000?
Show worked solution →

Part (a): a fixed monthly increase is an arithmetic sequence. The first repayment is a=200a = 200 and each month adds a constant $50, so d=50d = 50 and

Tn=a+(n1)d=200+50(n1)=150+50n.T_n = a + (n - 1)d = 200 + 50(n - 1) = 150 + 50n.

Part (b): the 24-month total is S24S_{24}.

S24=n2(2a+(n1)d)=242(2(200)+23(50))=12(400+1150)=12×1550=18600.S_{24} = \frac{n}{2}\big(2a + (n - 1)d\big) = \frac{24}{2}\big(2(200) + 23(50)\big) = 12\big(400 + 1150\big) = 12 \times 1550 = 18600.

So $18600 is repaid after 2424 months.

Part (c): solve Sn30000S_n \ge 30000. With Sn=n2(400+50(n1))=n2(50n+350)=25n2+175nS_n = \dfrac{n}{2}(400 + 50(n - 1)) = \dfrac{n}{2}(50n + 350) = 25n^2 + 175n,

25n2+175n30000n2+7n12000.25n^2 + 175n \ge 30000 \quad\Rightarrow\quad n^2 + 7n - 1200 \ge 0.

Solving the boundary quadratic,

n=7+49+48002=7+48492=7+69.635231.3.n = \frac{-7 + \sqrt{49 + 4800}}{2} = \frac{-7 + \sqrt{4849}}{2} = \frac{-7 + 69.635\ldots}{2} \approx 31.3.

The running total is below $30000 at n=31n = 31 and above it at n=32n = 32. Check: S31=25(961)+175(31)=24025+5425=29450S_{31} = 25(961) + 175(31) = 24025 + 5425 = 29450, and S32=25(1024)+175(32)=25600+5600=31200S_{32} = 25(1024) + 175(32) = 25600 + 5600 = 31200. So the total first reaches $30000 in month 32.

Marker's note: one mark for d=50d = 50 and the formula for TnT_n, one for S24=18600S_{24} = 18600, one for forming the inequality n2+7n12000n^2 + 7n - 1200 \ge 0, one for solving it, one for rounding up with a check to month 3232. Rounding 31.331.3 down to 3131 (where the total is still below target) is the standard error.

exam4 marksLogs are stacked so that the bottom row holds 3030 logs, and each row above holds 22 fewer than the row below. The stack ends with a top row of 66 logs. (a) How many rows are in the stack? (b) How many logs are in the stack altogether?
Show worked solution →

Part (a): the row counts form an arithmetic sequence. From the bottom up, a=30a = 30 and each row loses 22, so d=2d = -2. The top row has 66 logs, so it is the term equal to 66:

Tn=a+(n1)d=30+(n1)(2)=6.T_n = a + (n - 1)d = 30 + (n - 1)(-2) = 6.

302(n1)=62(n1)=24n1=12n=13.30 - 2(n - 1) = 6 \quad\Rightarrow\quad 2(n - 1) = 24 \quad\Rightarrow\quad n - 1 = 12 \quad\Rightarrow\quad n = 13.

So there are 1313 rows.

Part (b): total logs is S13S_{13}. Using the first-and-last form with a=30a = 30 and l=6l = 6,

S13=n2(a+l)=132(30+6)=132×36=13×18=234.S_{13} = \frac{n}{2}(a + l) = \frac{13}{2}(30 + 6) = \frac{13}{2} \times 36 = 13 \times 18 = 234.

So the stack holds 234234 logs.

Marker's note: one mark for d=2d = -2, one for solving Tn=6T_n = 6 to get n=13n = 13, one for the correct sum formula, one for the total 234234. The n2(a+l)\frac{n}{2}(a + l) form is fastest here because both ends are known; using n2(2a+(n1)d)\frac{n}{2}(2a + (n - 1)d) works too but invites arithmetic slips.

ExamExplained