Skip to main content
ExamExplained
NSW · Chemistry
Chemistry study scene
§-Syllabus dot point
NSWChemistrySyllabus dot point

Inquiry Question 5: How are esters formed, what are their properties, and how are they used?

Explain the structure of soaps and detergents, their formation by saponification (base hydrolysis of an ester) or by sulfonation, and how the hydrophilic and hydrophobic ends of the molecule give rise to the cleaning action of a micelle

A focused answer to the HSC Chemistry Module 7 dot point on soaps and detergents. The saponification reaction that converts a triglyceride ester into soap and glycerol, the hydrophilic carboxylate head and hydrophobic hydrocarbon tail, how micelles trap grease during cleaning, soap versus synthetic detergent in hard water, and worked HSC-style questions.

Reviewed by: AI editorial process; not yet individually human-reviewed

Have a quick question? Jump to the Q&A page

Jump to a section
  1. What this dot point is asking
  2. The answer
  3. Examples in context
  4. Try this

What this dot point is asking

NESA wants you to explain THREE linked ideas: (1) how a soap is made from a triglyceride ester by saponification, (2) the structure of the resulting soap or detergent molecule, specifically its hydrophilic (water-loving) head and hydrophobic (water-hating) tail, and (3) how that structure explains the cleaning action, through micelle formation around grease. You should also be able to compare soap with synthetic detergents, particularly their different behaviour in hard water.

The answer

Saponification: making soap from a triglyceride ester

A natural fat or oil is a triglyceride: an ester formed from glycerol (propane-1,2,3-triol, a triol with three -OH groups) and three long-chain carboxylic acids called fatty acids, joined through three ester linkages.

Saponification is the base hydrolysis of this triester. Refluxing the fat with hot concentrated aqueous NaOH breaks all three ester bonds, releasing glycerol and converting each fatty acid chain into its sodium carboxylate salt, which is soap:

C3H5(OOCR)3+3NaOHC3H5(OH)3+3RCOONa+C_3H_5(OOCR)_3 + 3NaOH \rightarrow C_3H_5(OH)_3 + 3RCOO^{-}Na^{+}

where R is a long hydrocarbon chain, typically 11 to 17 carbons long.

Saponification reaction scheme A reaction scheme showing a triglyceride (glycerol backbone with three ester-linked fatty acid tails) reacting with three equivalents of hot concentrated sodium hydroxide under reflux to give glycerol and three molecules of soap, each a sodium carboxylate with a hydrophilic ionic head and a hydrophobic hydrocarbon tail. triglyceride 3 ester links 3 NaOH reflux, heat glycerol (3 OH groups) 3 x soap hydrophilic head (-COO-Na+) hydrophobic tail (hydrocarbon)

Structure of a soap or detergent molecule

Every soap or detergent molecule is amphiphilic: it has two chemically distinct regions.

  • Hydrophobic tail. A long, non-polar hydrocarbon chain (roughly 11 to 17 carbons for soap). It cannot hydrogen-bond with water and is repelled from the bulk aqueous phase. This is the part of the molecule that dissolves readily into grease and oils (which are also non-polar).
  • Hydrophilic head. A small, charged or highly polar group. In soap this is a carboxylate ion, COO-COO^{-}, paired with Na+Na^{+} or K+K^{+}. In a synthetic detergent it is usually a sulfonate (SO3-SO_3^{-}) or sulfate (OSO3-OSO_3^{-}) group. This head forms strong ion-dipole interactions with water and keeps the whole molecule dispersible in the aqueous wash.

Cleaning action: how a micelle removes grease

Grease and oily dirt are non-polar, so water alone cannot dissolve or lift them off a surface (like attracts like: water only dissolves polar or ionic substances well). Soap solves this because it can interact with BOTH environments at once.

  1. During washing (with agitation), the hydrophobic tails of many soap molecules push into a grease droplet, dissolving into it.
  2. The hydrophilic heads remain oriented outward, in contact with the surrounding water.
  3. Enough soap molecules arrange this way to form a spherical micelle: grease trapped in a hydrophobic core, with a shell of hydrophilic carboxylate heads facing the water.
  4. Because the outside of the micelle is charged and hydrophilic, the whole grease-containing droplet is now compatible with water and can be washed away with the rinse water, rather than clinging to the fabric or dish.

Soap versus synthetic detergents in hard water

Hard water contains dissolved Ca2+Ca^{2+} and Mg2+Mg^{2+} ions. These react with the carboxylate head of soap to form an insoluble precipitate, commonly called soap scum:

2RCOO(aq)+Ca(aq)2+(RCOO)2Ca(s)2RCOO^{-}_{(aq)} + Ca^{2+}_{(aq)} \rightarrow (RCOO)_2Ca_{(s)}

This removes active soap from solution and leaves a visible scum on fabric, skin and surfaces. Synthetic detergents avoid this problem: their sulfonate (SO3-SO_3^{-}) or sulfate heads form calcium and magnesium salts that remain SOLUBLE, so no scum forms and cleaning performance is unaffected by water hardness. Synthetic detergents can also be tailored (branched vs linear hydrocarbon tails) to control biodegradability, an environmental consideration soap does not require since it is naturally derived and readily broken down by micro-organisms.

Examples in context

Example 1. Traditional soap-making from tallow at a small NSW producer. A boutique soap maker in regional NSW saponifies beef tallow (rich in tripalmitin and tristearin triglycerides) with concentrated sodium hydroxide solution in a heated kettle, then adds salt to "salt out" the solid soap from the glycerol-containing liquid, a process called salting-out that exploits the soap's lower solubility in the resulting brine. The recovered glycerol by-product is often sold separately for use as a moisturiser, illustrating the same saponification chemistry taught in Module 7 scaled up to a commercial batch process.

Example 2. Choosing a laundry detergent for a Sydney household on tank water versus town hard water. A household using naturally soft tank water can use a simple soap-based wash with no scum problems, but a household on mains water in a region with high dissolved calcium carbonate hardness typically needs a synthetic sulfonate or sulfate detergent (or a water softener) to avoid the grey, scummy residue that soap leaves on hard-water-washed fabric. This is a direct real-world consequence of the different solubility behaviour of carboxylate versus sulfonate calcium salts covered in this dot point.

Try this

Q1. State the reagent, condition, and both products of saponification of a triglyceride fat. [3 marks]

  • Cue. Hot concentrated NaOH, reflux; products are soap (sodium carboxylate) and glycerol.

Q2. A student saponifies 20.2 g of tripalmitin (M=807.3 g mol1M = 807.3\ \text{g mol}^{-1}) with excess NaOH. Calculate the theoretical mass of sodium palmitate (M=278.4 g mol1M = 278.4\ \text{g mol}^{-1}) produced, to 3 significant figures. [3 marks]

  • Cue. n(tripalmitin)=20.2/807.3=0.02503n(\text{tripalmitin}) = 20.2 / 807.3 = 0.02503 mol; n(soap)=3×0.02503=0.07509n(\text{soap}) = 3 \times 0.02503 = 0.07509 mol; m=0.07509×278.4=20.9m = 0.07509 \times 278.4 = 20.9 g.

Q3. Explain why a synthetic sulfonate detergent continues to clean effectively in hard water while soap forms a scum. [4 marks]

  • Cue. Ca2+Ca^{2+}/Mg2+Mg^{2+} form an insoluble precipitate with the carboxylate head of soap; sulfonate calcium/magnesium salts remain soluble, so the detergent's hydrophilic head stays functional and micelles can still form.

Practice questions

Original practice questions graded from foundation to exam level, each with a full worked solution. Try them before revealing the solution.

foundation3 marksState the reagent and condition for the saponification of a fat, name the two products formed, and identify which functional group in the fat is broken during the reaction.
Show worked solution →

A 3-mark identify needs the reagent/condition, both products, and the functional group.

Reagent and condition
Hot concentrated aqueous NaOH, reflux.
Products
Soap (the sodium salt of a long-chain carboxylic acid, i.e. a carboxylate) and glycerol (propane-1,2,3-triol).
Functional group broken
The ester linkage (COO-COO-) in the triglyceride; base hydrolysis cleaves each of the three ester bonds.

Marking criteria: 1 mark for the correct reagent and condition, 1 mark for naming BOTH products correctly, 1 mark for correctly identifying the ester linkage as the group hydrolysed.

foundation4 marksDraw a simplified diagram of a single soap molecule showing the hydrophilic and hydrophobic regions, label each region, and explain in one sentence why each region interacts with water the way it does.
Show worked solution →

Diagram (described). A zig-zag hydrocarbon tail (representing CH3(CH2)16CH_3(CH_2)_{16}-, roughly 16 to 17 carbons) drawn on the left, connected to a carboxylate head (COONa+-COO^{-}Na^{+}) drawn on the right as a small charged group.

Labels and explanation.

  • Hydrophobic tail (the long hydrocarbon chain): non-polar, so it cannot form hydrogen bonds with polar water molecules and is repelled from the bulk water phase.
  • Hydrophilic head (the ionic carboxylate, COO-COO^{-}): charged, so it is strongly attracted to polar water molecules through ion-dipole interactions and dissolves readily in water.

Marking criteria: 1 mark for a recognisable tail-and-head sketch, 1 mark for correctly labelling the hydrophobic tail, 1 mark for correctly labelling the hydrophilic head, 1 mark for a correct explanation linking polarity/charge to the water interaction for at least one region.

core5 marksA student saponifies 40.4 g of the triglyceride tripalmitin (M=807.3 g mol1M = 807.3\ \text{g mol}^{-1}) with excess hot concentrated NaOH. Calculate the theoretical mass of sodium palmitate soap (M=278.4 g mol1M = 278.4\ \text{g mol}^{-1}) produced, to 3 significant figures, given that each triglyceride molecule produces three soap molecules on complete saponification.
Show worked solution →

Step 1: write the equation (1:3 stoichiometry, tripalmitin to soap).

C3H5(OOC(CH2)14CH3)3+3NaOHC3H5(OH)3+3CH3(CH2)14COONaC_3H_5(OOC(CH_2)_{14}CH_3)_3 + 3NaOH \rightarrow C_3H_5(OH)_3 + 3CH_3(CH_2)_{14}COONa

One mole of tripalmitin produces three moles of sodium palmitate (soap).

Step 2: moles of tripalmitin.

n(tripalmitin)=mM=40.4 g807.3 g mol1=0.050043 moln(\text{tripalmitin}) = \frac{m}{M} = \frac{40.4\ \text{g}}{807.3\ \text{g mol}^{-1}} = 0.050043\ \text{mol}

Step 3: moles of soap (1:3 ratio).

n(soap)=3×0.050043 mol=0.150130 moln(\text{soap}) = 3 \times 0.050043\ \text{mol} = 0.150130\ \text{mol}

Step 4: mass of soap.

m=n×M=0.150130 mol×278.4 g mol1=41.796 gm = n \times M = 0.150130\ \text{mol} \times 278.4\ \text{g mol}^{-1} = 41.796\ \text{g}

Step 5: round to 3 significant figures (matching the data, 40.4 g has 3 s.f.).

m(soap)=41.8 gm(\text{soap}) = 41.8\ \text{g}

Marking criteria: 1 mark for the correct balanced 1:3 relationship, 1 mark for correct moles of tripalmitin, 1 mark for correctly applying the 1:3 ratio, 1 mark for the mass calculation, 1 mark for the correct answer to 3 significant figures with units. Note this is a THEORETICAL (100 percent yield) value; excess NaOH is present to ensure the ester is fully consumed, but a real preparation would give a somewhat lower practical yield due to incomplete separation and losses on washing/salting-out.

core5 marksThe IR spectrum below is an owned illustrative spectrum showing the change from a fat sample (curve A, dashed) to its saponification product (curve B, solid) after reaction with hot concentrated NaOH. Identify the key peak that disappears, the key peak that appears in its place, and explain what this change confirms about the reaction.
Show worked solution →

Reading the spectrum. Curve A (the starting fat) shows a strong, sharp peak near 1745 cm1cm^{-1}. Curve B (the product after saponification) has lost that peak and instead shows a peak near 1580 cm1cm^{-1}.

Interpretation.

  • The peak near 1745 cm1cm^{-1} in curve A is the C=OC=O stretch of an ESTER carbonyl, consistent with the triglyceride's three ester linkages.
  • The disappearance of this peak in curve B, replaced by a new peak near 1580 cm1cm^{-1} (the asymmetric stretch of the ionic carboxylate group, COO-COO^{-}), confirms the ester linkage has been hydrolysed and converted into a carboxylate salt.
  • Together, the loss of the ester carbonyl peak and the appearance of the carboxylate peak is diagnostic evidence that saponification has occurred, converting the fat into soap.

Marking criteria: 1 mark for identifying the ester carbonyl peak and its approximate region in curve A, 1 mark for identifying the new carboxylate peak and its approximate region in curve B, 1 mark for stating the ester peak disappears while the carboxylate peak appears, 1 mark for correctly reasoning that this is diagnostic of ester hydrolysis, 1 mark for explicitly concluding that saponification (conversion to soap) has occurred.

core6 marksExplain, with reference to the structure of a soap molecule, why soap forms a scum in hard water while a synthetic sulfonate detergent does not, and outline the chemistry occurring in each case.
Show worked solution →

Soap in hard water. Hard water contains dissolved Ca2+Ca^{2+} and Mg2+Mg^{2+} ions. The hydrophilic head of a soap molecule is a carboxylate, RCOORCOO^{-}. Calcium and magnesium carboxylate salts, e.g. (RCOO)2Ca(RCOO)_2Ca, are INSOLUBLE in water, so these ions precipitate the soap as an insoluble scum:

2RCOO(aq)+Ca(aq)2+(RCOO)2Ca(s)2RCOO^{-}_{(aq)} + Ca^{2+}_{(aq)} \rightarrow (RCOO)_2Ca_{(s)}

This removes soap from solution (reducing its cleaning effectiveness) and leaves an insoluble scum deposit on surfaces and fabric.

Synthetic detergent in hard water. A synthetic detergent's hydrophilic head is typically a sulfonate, RSO3RSO_3^{-}. Calcium and magnesium sulfonate salts, (RSO3)2Ca(RSO_3)_2Ca and (RSO3)2Mg(RSO_3)_2Mg, remain SOLUBLE in water, so no precipitate forms and the detergent's cleaning ability is unaffected by hard water ions.

Why the difference. The difference in solubility arises from the different anions: carboxylate calcium/magnesium salts have a low solubility product, while sulfonate calcium/magnesium salts do not readily precipitate under normal washing conditions. This structural difference (carboxylate head vs sulfonate head) is the key reason synthetic detergents were developed as an alternative to natural soap for regions with hard water supplies.

Marking criteria: 1 mark for identifying Ca2+Ca^{2+}/Mg2+Mg^{2+} as the hard-water ions responsible, 1 mark for correctly identifying the carboxylate head as the soap's reactive group, 1 mark for a correct precipitation equation or clearly stated insoluble product for soap, 1 mark for identifying the sulfonate head of the detergent, 1 mark for correctly stating that calcium/magnesium sulfonates remain soluble, 1 mark for a clear concluding explanation linking head-group structure to the observed difference.

exam7 marksThe graph below shows the surface tension of water measured as increasing amounts of a soap are added, reaching a plateau once the critical micelle concentration (CMC) is exceeded. (a) Describe the shape of the curve and explain, in terms of soap structure, why surface tension falls as soap is added. (b) Explain why the curve plateaus beyond the CMC rather than continuing to fall.
Show worked solution →

(a) Description and explanation. Surface tension starts high (close to that of pure water) and falls steeply as soap concentration increases from zero, then the rate of decrease slows and the curve flattens once the CMC is reached. Soap molecules are amphiphilic: below the CMC, they accumulate at the air-water interface with hydrophobic tails oriented away from the water and hydrophilic heads in the water, disrupting the hydrogen-bonding network between water molecules at the surface. This disruption is what lowers the surface tension as more soap is added.

(b) Explanation of the plateau. Once the interface is fully saturated with soap molecules (the CMC is reached), any additional soap added can no longer adsorb at the surface. Instead, extra soap molecules aggregate into micelles within the bulk solution, with hydrophobic tails clustered inward and hydrophilic heads facing outward into the water. Because the air-water interface is already saturated, adding more soap beyond the CMC does not further lower the surface tension, so the curve plateaus.

Marking criteria: (a) 1 mark for describing the shape (steep fall then plateau), 1 mark for correctly linking the fall in surface tension to amphiphilic soap molecules disrupting water's hydrogen-bonding at the interface. (b) 1 mark for identifying the CMC as the point of interface saturation, 1 mark for explaining that additional soap forms micelles in the bulk solution rather than adsorbing at the surface, 1 mark for correctly concluding that surface tension therefore does not fall further, 1 mark for a clear, complete explanation connecting both parts (a) and (b) into one coherent account of surfactant behaviour.

exam8 marksEvaluate the effectiveness of soap compared with a synthetic sulfonate detergent as a general-purpose cleaning agent, considering hard-water performance, biodegradability, and the chemistry of grease removal by micelle formation.
Show worked solution →

This is an 8-mark EVALUATE: markers reward a balanced judgement supported by chemistry from both sides, not just a list of facts.

Band 6 PLAN.

  • Thesis: a synthetic sulfonate detergent is generally more effective than soap as a general-purpose cleaner because it performs consistently in hard water, even though soap has an environmental advantage in biodegradability; the shared mechanism of grease removal (micelle formation) is equally effective for both once each is actually dissolved and available in solution.
  • Grease removal mechanism (common to both): the hydrophobic tail of the surfactant (carboxylate for soap, sulfonate for detergent) dissolves into and surrounds non-polar grease/oil droplets during agitation, while the hydrophilic head remains oriented outward into the water, forming a stable micelle that can be rinsed away with the wash water. This mechanism is essentially identical for soap and for the synthetic detergent, since both are amphiphilic surfactants.
  • Hard-water performance (the key point of difference): soap's carboxylate head forms an insoluble precipitate with Ca2+Ca^{2+}/Mg2+Mg^{2+} in hard water (2RCOO+Ca2+(RCOO)2Ca2RCOO^{-} + Ca^{2+} \rightarrow (RCOO)_2Ca), removing active soap from solution and leaving a scum; the detergent's sulfonate head forms soluble calcium/magnesium salts, so its full concentration remains available to form micelles and clean effectively regardless of water hardness.
  • Biodegradability (soap's advantage): soap is derived from natural fats/oils and its carboxylate structure is readily broken down by microorganisms; early synthetic detergents with heavily branched hydrocarbon tails were far less biodegradable and persisted in waterways, though modern linear-chain sulfonate detergents have been redesigned to biodegrade much more readily, narrowing this gap.
  • Judgement: for hard-water regions and consistent cleaning performance, the synthetic sulfonate detergent is the more effective general-purpose cleaner; soap remains preferable only where minimising synthetic chemical persistence in the environment is the primary concern and water is soft.

Model paragraph (excerpt). Both soap and synthetic sulfonate detergents clean by the same fundamental mechanism: an amphiphilic molecule with a hydrophobic tail and a hydrophilic head forms a micelle around grease during agitation, trapping the non-polar droplet inside a shell of charged heads that keeps it dispersed in the wash water until rinsing removes it. Where the two diverge is hard water: soap's carboxylate head precipitates with calcium and magnesium ions as an insoluble scum, depleting the concentration of active surfactant and reducing cleaning power, whereas a detergent's sulfonate head remains fully soluble under the same conditions, so its cleaning effectiveness is unaffected by water hardness. This single structural difference in the hydrophilic head group is therefore the main reason synthetic detergents are generally more effective general-purpose cleaners than soap, notwithstanding soap's continued advantage in biodegradability.

Marker's note: top-band answers (1) correctly describe the shared micelle mechanism using both hydrophobic and hydrophilic terminology, (2) give the correct chemistry (an equation or clearly stated insoluble/soluble products) for the hard-water difference, (3) address biodegradability as a genuine counterpoint rather than ignoring it, and (4) end with an explicit, justified judgement rather than a neutral list of pros and cons.

ExamExplained