Skip to main content
ExamExplained
NSW · Chemistry
Chemistry study scene
§-Syllabus dot point
NSWChemistrySyllabus dot point

Inquiry Question 4: How does solubility relate to chemical equilibrium and the position of equilibrium?

Predict the solubility of an ionic substance by applying solubility equilibrium principles, and perform calculations involving the solubility product constant (Ksp) and the ionic product

A focused answer to the HSC Chemistry Module 5 dot point on the solubility product. Writing Ksp expressions, predicting precipitation using the ionic product Q vs Ksp, the common ion effect, and worked HSC calculations for solubility and precipitation.

Reviewed by: AI editorial process; not yet individually human-reviewed

Have a quick question? Jump to the Q&A page

Jump to a section
  1. What this dot point is asking
  2. The answer
  3. Worked example 2: the common ion effect
  4. Examples in context
  5. Try this

What this dot point is asking

NESA wants you to write Ksp expressions for sparingly soluble salts, calculate molar solubility, predict whether a precipitate will form by comparing the ionic product Q to Ksp, and understand the common ion effect. This dot point is examined as a 3-5 mark calculation question and as part of extended response questions on environmental chemistry.

The answer

The solubility product Ksp

For a sparingly soluble ionic compound, dissolution is an equilibrium between the solid and its ions in solution:

MaXb(s)aM(aq)n++bX(aq)m\text{M}_a\text{X}_{b(s)} \rightleftharpoons a\text{M}^{n+}_{(aq)} + b\text{X}^{m-}_{(aq)}

The solubility product constant Ksp is the equilibrium constant for this dissolution. The pure solid is excluded, so:

Ksp=[Mn+]a[Xm]bK_{sp} = [\text{M}^{n+}]^a [\text{X}^{m-}]^b

Examples:

Compound Dissolution Ksp expression
AgClAgCl AgCl(s)Ag++ClAgCl_{(s)} \rightleftharpoons Ag^+ + Cl^- [Ag+][Cl][Ag^+][Cl^-]
PbCl2PbCl_2 PbCl2(s)Pb2++2ClPbCl_{2(s)} \rightleftharpoons Pb^{2+} + 2Cl^- [Pb2+][Cl]2[Pb^{2+}][Cl^-]^2
Ca3(PO4)2Ca_3(PO_4)_2 Ca3(PO4)2(s)3Ca2++2PO43Ca_3(PO_4)_{2(s)} \rightleftharpoons 3Ca^{2+} + 2PO_4^{3-} [Ca2+]3[PO43]2[Ca^{2+}]^3[PO_4^{3-}]^2

Ksp values are small (typically 10510^{-5} to 105010^{-50}), reflecting the fact that the compound is only slightly soluble.

The ionic product Q

For any solution (not necessarily at equilibrium), the same expression evaluated using current concentrations is the ionic product Q.

Compare Q to Ksp to predict precipitation:

  • If Q<KspQ < K_{sp}, the solution is unsaturated. More solid can dissolve. No precipitate forms.
  • If Q=KspQ = K_{sp}, the solution is saturated. The system is at equilibrium.
  • If Q>KspQ > K_{sp}, the solution is supersaturated. A precipitate forms until Q falls back to Ksp.

The common ion effect

Adding a common ion to a saturated solution decreases solubility. For example, adding NaCl to a saturated solution of AgCl increases [Cl][Cl^-], so [Ag+][Ag^+] must decrease to keep Q=KspQ = K_{sp}. Some AgCl precipitates.

This is a direct application of Le Chatelier's principle. The added ion shifts the dissolution equilibrium to the left (toward the solid).

Solubility of potassium nitrate and sodium chloride versus temperature Owned illustrative graph of solubility in grams per 100 grams of water plotted against temperature in degrees Celsius from 0 to 100. The potassium nitrate curve rises steeply from about 20 at 0 degrees to over 240 at 100 degrees, reflecting a strongly endothermic, temperature-sensitive dissolution equilibrium. The sodium chloride curve rises only gently, from about 36 at 0 degrees to about 39 at 100 degrees, reflecting a dissolution equilibrium that is close to thermally neutral. Solubility (g / 100 g water) Temperature (°C) 250 180 110 40 0 0 20 40 60 80 100 KNO₃ (steep, endothermic) NaCl (nearly flat, thermally neutral) Illustrative ExamExplained data. Steepness reflects how sensitive the dissolution equilibrium is to added heat.

Worked example 2: the common ion effect

Calculate the molar solubility of AgClAgCl (Ksp=1.8×1010K_{sp} = 1.8 \times 10^{-10}) in 0.10 mol/L NaClNaCl, and compare with its solubility in pure water.

Step 1: Account for the common ion. NaClNaCl fully dissociates, so [Cl][Cl^-] from the salt is 0.10 mol/L before any AgCl dissolves. Let ss' be the molar solubility of AgCl in this solution.

Ag+Ag^+ ClCl^-
From NaClNaCl 0 0.10
From dissolved AgClAgCl +s+s' +s+s'
Equilibrium ss' 0.10+s0.10 + s'

Step 2: Substitute into Ksp.

Ksp=[Ag+][Cl]=s(0.10+s)=1.8×1010K_{sp} = [Ag^+][Cl^-] = s'(0.10 + s') = 1.8 \times 10^{-10}

Step 3: Approximate. Because Ksp is tiny and [Cl][Cl^-] from NaCl is much larger than ss', 0.10+s0.100.10 + s' \approx 0.10.

s1.8×10100.10=1.8×109 mol/Ls' \approx \frac{1.8 \times 10^{-10}}{0.10} = 1.8 \times 10^{-9} \text{ mol/L}

Step 4: Compare. In pure water s=1.34×105s = 1.34 \times 10^{-5} mol/L; in 0.10 mol/L NaCl, s=1.8×109s' = 1.8 \times 10^{-9} mol/L. The solubility falls by a factor of ~7400. Adding the common ion drives the equilibrium to the left (toward solid), exactly as Le Chatelier's principle predicts.

Check the approximation. s/0.10=1.8×108s' / 0.10 = 1.8 \times 10^{-8}, far below 5%. Valid.

The common ion effect shifting the AgCl dissolution equilibrium A schematic reaction scheme showing solid silver chloride in equilibrium with dissolved silver and chloride ions. Adding sodium chloride raises the chloride ion concentration, which by Le Chatelier's principle pushes the equilibrium to the left, back toward the solid, so more silver chloride precipitates and the silver ion concentration falls. AgCl(s) solid Ag⁺(aq) + Cl⁻(aq) forward (dissolve) reverse dominates (precipitate) add NaCl(aq) raises [Cl⁻] Le Chatelier: raising a product concentration shifts the equilibrium toward the reactant side, i.e. back toward the solid, so [Ag⁺] falls while Q is forced back down to Kₛₔ. Illustrative ExamExplained scheme, based on Ksp(AgCl) = 1.8 × 10⁻¹⁰.

Examples in context

Example 1. Cadia gold mine cyanide leach circuit. At Newmont's Cadia operation near Orange, gold is dissolved as the soluble dicyanoaurate complex, but trace metals must be precipitated out before tailings discharge. Engineers control the silver content of the spent solution by manipulating the equilibrium AgCl(s)Ag(aq)++Cl(aq)AgCl_{(s)} \rightleftharpoons Ag^+_{(aq)} + Cl^-_{(aq)}, with Ksp=1.8×1010K_{sp} = 1.8 \times 10^{-10}. Adding excess chloride to the leach residue drives the common-ion effect, dropping [Ag+][Ag^+] to well below regulatory limits. The same Ksp framework students apply to lead chloride precipitation problems in HSC Section II underpins the real-time process control at the tailings dam.

Example 2. Hard-water scaling in Hunter Valley irrigation pipes. Bore water along the Hunter Valley vineyard belt contains calcium and carbonate above the saturation threshold for CaCO3CaCO_3, with Ksp=3.4×109K_{sp} = 3.4 \times 10^{-9}. Pipe inspections after summer reveal a hard white scale on the inside of irrigation lines. Calculating the ionic product Q=[Ca2+][CO32]Q = [Ca^{2+}][CO_3^{2-}] from a typical bore reading of [Ca2+]=2.0×103[Ca^{2+}] = 2.0 \times 10^{-3} and [CO32]=3.0×105[CO_3^{2-}] = 3.0 \times 10^{-5} mol L1^{-1} gives Q=6.0×108Q = 6.0 \times 10^{-8}, well above Ksp, so calcite precipitates. The same calculation tells maintenance crews when to dose with acid or replace pipe runs.

Try this

Q1. Write the Ksp expression for silver chromate, Ag2CrO4(s)2Ag(aq)++CrO42(aq)Ag_2CrO_{4(s)} \rightleftharpoons 2Ag^+_{(aq)} + CrO_4^{2-(aq)}, and state the units. [2 marks]

  • Cue. Ksp=[Ag+]2[CrO42]K_{sp} = [Ag^+]^2[CrO_4^{2-}], with units mol3^3 L3^{-3} for the unsymmetrical 2:1 salt.

Q2. The Ksp of PbI2PbI_2 is 7.1×1097.1 \times 10^{-9}. Calculate the molar solubility of PbI2PbI_2 in pure water. [3 marks]

  • Cue. Let ss = molar solubility, then [Pb2+]=s[Pb^{2+}] = s and [I]=2s[I^-] = 2s, so Ksp=s(2s)2=4s3K_{sp} = s(2s)^2 = 4s^3; s=7.1×109/43=1.21×103s = \sqrt[3]{7.1 \times 10^{-9} / 4} = 1.21 \times 10^{-3} mol L1^{-1}.

Q3. A solution contains [Ba2+]=1.0×104[Ba^{2+}] = 1.0 \times 10^{-4} mol L1^{-1} and [SO42]=5.0×105[SO_4^{2-}] = 5.0 \times 10^{-5} mol L1^{-1}. Given that Ksp(BaSO4)=1.1×1010K_{sp}(BaSO_4) = 1.1 \times 10^{-10}, (a) calculate QQ, (b) predict whether a precipitate forms, (c) explain how adding sodium sulfate would change the answer. [2+1+2 marks]

  • Cue. (a) Q=1.0×104×5.0×105=5.0×109Q = 1.0 \times 10^{-4} \times 5.0 \times 10^{-5} = 5.0 \times 10^{-9}. (b) Q>KspQ > K_{sp}, so BaSO4BaSO_4 precipitates. (c) Common-ion effect raises [SO42][SO_4^{2-}], QQ increases further, more precipitate forms.

Exam-style practice questions

Practice questions written in the style of NESA exam questions on this dot point, with worked answer explainers. The year tag is the paper they imitate, not the source.

2020 HSC4 marksThe Ksp of silver chloride (AgCl) at 25°C is 1.8 × 10⁻¹⁰. Calculate the molar solubility of silver chloride in pure water at 25°C.
Show worked answer →

A 4 mark answer needs the dissolution equation, the Ksp expression, the algebraic solution, and the final value with units.

Step 1: Dissolution equation.

AgCl(s)Ag(aq)++Cl(aq)AgCl_{(s)} \rightleftharpoons Ag^+_{(aq)} + Cl^-_{(aq)}

Step 2: Ksp expression. Pure solid AgCl is excluded.

Ksp=[Ag+][Cl]K_{sp} = [Ag^+][Cl^-]

Step 3: Set up using molar solubility ss.

Each mole of AgCl that dissolves gives 1 mole of Ag+Ag^+ and 1 mole of ClCl^-, so [Ag+]=[Cl]=s[Ag^+] = [Cl^-] = s.

Ksp=s×s=s2=1.8×1010K_{sp} = s \times s = s^2 = 1.8 \times 10^{-10}

Step 4: Solve.

s=1.8×1010=1.34×105 mol/Ls = \sqrt{1.8 \times 10^{-10}} = 1.34 \times 10^{-5} \text{ mol/L}

Markers reward (1) the balanced dissolution equation with state symbols, (2) the correct Ksp expression (excluding the solid), (3) clear use of molar solubility ss with stoichiometry, (4) the answer in mol/L to appropriate significant figures.

2019 HSC3 marksEqual volumes of 0.0010 mol/L silver nitrate and 0.0020 mol/L sodium chloride are mixed. The Ksp of AgCl is 1.8 × 10⁻¹⁰. Determine, with calculation, whether a precipitate will form.
Show worked answer →

Mixing equal volumes halves each concentration.

After mixing:
[Ag+]=0.0010/2=5.0×104[Ag^+] = 0.0010 / 2 = 5.0 \times 10^{-4} mol/L.
[Cl]=0.0020/2=1.0×103[Cl^-] = 0.0020 / 2 = 1.0 \times 10^{-3} mol/L.

Calculate the ionic product Q.

Q=[Ag+][Cl]=(5.0×104)(1.0×103)=5.0×107Q = [Ag^+][Cl^-] = (5.0 \times 10^{-4})(1.0 \times 10^{-3}) = 5.0 \times 10^{-7}

Compare to Ksp.

Q=5.0×107Q = 5.0 \times 10^{-7} is much greater than Ksp=1.8×1010K_{sp} = 1.8 \times 10^{-10}.

Since Q>KspQ > K_{sp}, the solution is supersaturated and a precipitate of AgCl will form.

Markers reward (1) the dilution step (halving concentrations after mixing), (2) calculating Q correctly, (3) the explicit Q vs Ksp comparison and the conclusion.

Practice questions

Original practice questions graded from foundation to exam level, each with a full worked solution. Try them before revealing the solution.

foundation2 marksWrite the Ksp expression for magnesium hydroxide, Mg(OH)2(s)Mg(aq)2++2OH(aq)Mg(OH)_{2(s)} \rightleftharpoons Mg^{2+}_{(aq)} + 2OH^-_{(aq)}, and state its units.
Show worked solution →

Ksp expression. The solid is excluded:

Ksp=[Mg2+][OH]2K_{sp} = [\text{Mg}^{2+}][\text{OH}^-]^2

Units. Three ion terms are multiplied ([Mg2+][\text{Mg}^{2+}] to the first power, [OH][\text{OH}^-] squared), giving mol3^3 L3^{-3}.

Markers reward (1) the correct expression with OH- squared, (2) the solid correctly excluded, (3) correct units mol3^3 L3^{-3}.

foundation3 marksThe Ksp of silver bromide, AgBrAgBr, is 5.0×10135.0 \times 10^{-13} at 25°C. Calculate its molar solubility in pure water.
Show worked solution →

Step 1: Dissolution equation.

AgBr(s)Ag(aq)++Br(aq)AgBr_{(s)} \rightleftharpoons Ag^+_{(aq)} + Br^-_{(aq)}

Step 2: Ksp expression and substitution. Let molar solubility =s= s. Since the stoichiometry is 1:1, [Ag+]=[Br]=s[Ag^+] = [Br^-] = s.

Ksp=[Ag+][Br]=s2=5.0×1013K_{sp} = [Ag^+][Br^-] = s^2 = 5.0 \times 10^{-13}

Step 3: Solve.

s=5.0×1013=7.07×107 mol/L (3 s.f.)s = \sqrt{5.0 \times 10^{-13}} = 7.07 \times 10^{-7} \text{ mol/L (3 s.f.)}

Markers reward (1) the dissolution equation, (2) correct Ksp expression, (3) the final value in mol/L to appropriate significant figures.

core4 marksA student mixes 50.0 mL of 2.0×1042.0 \times 10^{-4} mol/L lead(II) nitrate with 50.0 mL of 4.0×1044.0 \times 10^{-4} mol/L potassium iodide. Given Ksp(PbI2)=7.1×109K_{sp}(PbI_2) = 7.1 \times 10^{-9}, determine with a full calculation whether a precipitate of PbI2PbI_2 forms.
Show worked solution →

Step 1: Correct for dilution. Equal volumes mixed, so each concentration halves.

[Pb2+]=2.0×1042=1.0×104 mol/L[Pb^{2+}] = \frac{2.0 \times 10^{-4}}{2} = 1.0 \times 10^{-4} \text{ mol/L}

[I]=4.0×1042=2.0×104 mol/L[I^-] = \frac{4.0 \times 10^{-4}}{2} = 2.0 \times 10^{-4} \text{ mol/L}

Step 2: Calculate the ionic product Q. PbI2Pb2++2IPbI_2 \rightleftharpoons Pb^{2+} + 2I^-, so Q=[Pb2+][I]2Q = [Pb^{2+}][I^-]^2.

Q=(1.0×104)(2.0×104)2=(1.0×104)(4.0×108)Q = (1.0 \times 10^{-4})(2.0 \times 10^{-4})^2 = (1.0 \times 10^{-4})(4.0 \times 10^{-8})

Q=4.0×1012Q = 4.0 \times 10^{-12}

Step 3: Compare to Ksp.

Q=4.0×1012Q = 4.0 \times 10^{-12} is less than Ksp=7.1×109K_{sp} = 7.1 \times 10^{-9}.

Step 4: Conclusion. Since Q<KspQ < K_{sp}, the mixed solution is unsaturated with respect to PbI2PbI_2, so no precipitate forms.

Markers reward (1) the dilution correction on both concentrations, (2) the correctly squared [I][I^-] term in Q, (3) the numerical value of Q to 2 s.f., (4) the explicit Q vs Ksp comparison and correct conclusion.

core5 marksThe graph below shows the solubility of potassium nitrate (KNO3KNO_3) and sodium chloride (NaClNaCl) against temperature (owned illustrative data, not measured Ksp values). (a) Describe the trend for each salt. (b) Explain, in terms of the dissolution equilibrium, why KNO3KNO_3 solubility is far more temperature-sensitive than NaClNaCl. (c) A saturated KNO3KNO_3 solution at 60°C (solubility about 110 g per 100 g water) is cooled to 20°C (solubility about 32 g per 100 g water). Calculate the mass of KNO3KNO_3 that crystallises from 250 g of water.
Show worked solution →
(a) Trend
KNO3KNO_3 solubility rises steeply and continuously with temperature (from about 20 g per 100 g water at 0°C to over 240 g per 100 g water at 100°C on the figure). NaClNaCl solubility rises only gently and almost linearly across the same range (about 36 to 39 g per 100 g water).
(b) Explanation
Dissolving KNO3KNO_3 is strongly endothermic, so by Le Chatelier's principle, raising temperature (adding heat, a "reactant") shifts the dissolution equilibrium strongly to the right, sharply increasing solubility. Dissolving NaClNaCl is close to thermally neutral (only weakly endothermic), so temperature has little effect on the equilibrium position and solubility barely changes.
(c) Calculation

Mass dissolved at 60°C in 250 g water:

m1=110100×250=275 gm_1 = \frac{110}{100} \times 250 = 275 \text{ g}

Mass that remains dissolved at 20°C in 250 g water:

m2=32100×250=80 gm_2 = \frac{32}{100} \times 250 = 80 \text{ g}

Mass that crystallises out:

Δm=m1m2=27580=195 g (3 s.f.)\Delta m = m_1 - m_2 = 275 - 80 = 195 \text{ g (3 s.f.)}

Markers reward (1) both trends described with approximate figures from the graph, (2) the endothermic dissolution / Le Chatelier explanation linking heat to equilibrium shift, (3) correct calculation of mass dissolved at each temperature, (4) correct final mass crystallised with units.

core4 marksCalculate the molar solubility of calcium fluoride, CaF2CaF_2 (Ksp=3.9×1011K_{sp} = 3.9 \times 10^{-11}), in a solution that is already 0.0200.020 mol/L in NaFNaF.
Show worked solution →

Step 1: Set up the common-ion table. CaF2Ca2++2FCaF_2 \rightleftharpoons Ca^{2+} + 2F^-. Let ss' be the molar solubility of CaF2CaF_2 in this solution. NaFNaF fully dissociates, giving [F]=0.020[F^-] = 0.020 mol/L before any CaF2CaF_2 dissolves.

[Ca2+]=s,[F]=0.020+2s[Ca^{2+}] = s', \quad [F^-] = 0.020 + 2s'

Step 2: Approximate. Since KspK_{sp} is tiny, 2s0.0202s' \ll 0.020, so [F]0.020[F^-] \approx 0.020 mol/L.

Step 3: Substitute into Ksp.

Ksp=[Ca2+][F]2=s(0.020)2=3.9×1011K_{sp} = [Ca^{2+}][F^-]^2 = s'(0.020)^2 = 3.9 \times 10^{-11}

s=3.9×10114.0×104=9.75×108 mol/Ls' = \frac{3.9 \times 10^{-11}}{4.0 \times 10^{-4}} = 9.75 \times 10^{-8} \text{ mol/L}

Step 4: Check the approximation. 2s=1.95×1072s' = 1.95 \times 10^{-7}, which is about 9.8×1049.8 \times 10^{-4} percent of 0.0200.020, far below the 5 percent threshold, so the approximation is valid.

Markers reward (1) correct common-ion table with the 2s2s' stoichiometric term, (2) valid approximation stated and later checked, (3) correct algebra substituting into Ksp, (4) final answer in mol/L to appropriate significant figures.

exam6 marksAnalyse how solubility equilibrium principles, including Ksp and the common ion effect, are applied to control dissolved metal ion concentrations in the treatment of mine wastewater before discharge.
Show worked solution →

Band 6 plan. (1) State the equilibrium underlying the problem: a sparingly soluble metal salt in equilibrium with its ions. (2) Define Ksp and Q, and state the precipitation criterion Q > Ksp. (3) Explain how operators exploit the common ion effect to force precipitation. (4) Link to Le Chatelier's principle. (5) Note the real engineering constraint (adding excess reagent, monitoring against a discharge limit) and evaluate a limitation.

Model answer.

Mine wastewater often contains dissolved heavy metal ions (e.g. Ag+Ag^+, Pb2+Pb^{2+}) at concentrations that exceed environmental discharge limits. These metals exist in equilibrium with sparingly soluble salts, for example AgCl(s)Ag(aq)++Cl(aq)AgCl_{(s)} \rightleftharpoons Ag^+_{(aq)} + Cl^-_{(aq)}, governed by Ksp=[Ag+][Cl]K_{sp} = [Ag^+][Cl^-].

To remove the metal, treatment plants deliberately raise the concentration of a common ion (commonly ClCl^- or S2S^{2-}) by dosing the wastewater with a soluble salt of that ion. This increases the ionic product Q=[Ag+][Cl]Q = [Ag^+][Cl^-] above KspK_{sp}, so the solution becomes supersaturated and the equilibrium shifts left (Le Chatelier's principle) as solid precipitates out, consuming free Ag+Ag^+ until QQ falls back to KspK_{sp}.

Because KspK_{sp} is fixed at a given temperature, adding a large excess of the common ion forces the equilibrium concentration of the target metal ion to a very low value, since [Ag+]=Ksp/[Cl][Ag^+] = K_{sp} / [Cl^-] falls as [Cl][Cl^-] rises. This is exactly the common ion effect used in HSC calculations, scaled to an industrial process.

A limitation is that excess reagent itself becomes a discharge concern (e.g. excess chloride or sulfide) and must be independently monitored, and the precipitate (sludge) requires safe disposal. Operators therefore dose only enough common ion to bring the target metal below its regulatory limit, verified by sampling and comparing measured concentrations against the calculated equilibrium value.

Marker's note: Top bands require the explicit Ksp/Q relationship (not just "add a chemical to precipitate it"), the Le Chatelier link, a real named ion pair, AND an evaluative limitation. Mid-band responses often state the common ion effect correctly but never connect it back to the Ksp expression or fail to evaluate.

ExamExplained