Skip to main content
ExamExplained
NSW · Chemistry
Chemistry study scene
§-Syllabus dot point
NSWChemistrySyllabus dot point

Inquiry Question 5: How are acids and bases defined and how do they behave in aqueous solution?

Investigate the structure and properties of buffer systems, including their composition, how they resist pH change, and their importance in natural systems such as blood

A focused answer to the HSC Chemistry Module 5 dot point on buffer systems. The composition of a buffer (weak acid plus conjugate base), how the equilibrium resists pH change, the Henderson-Hasselbalch equation, the carbonic acid blood buffer, and worked HSC past exam questions.

Reviewed by: AI editorial process; not yet individually human-reviewed

Have a quick question? Jump to the Q&A page

Jump to a section
  1. What this dot point is asking
  2. The answer
  3. Worked example 2: designing a buffer
  4. Examples in context
  5. Try this

What this dot point is asking

NESA wants you to describe what a buffer is, explain how the weak acid / conjugate base equilibrium resists pH change, use the Henderson-Hasselbalch equation for buffer pH calculations, and apply this to natural buffer systems (especially the carbonic acid / bicarbonate buffer in blood). This is a popular extended-response topic combining Brønsted-Lowry acid-base theory with Le Chatelier reasoning.

The answer

What a buffer is

A buffer solution resists changes in pH when small amounts of acid or base are added (or when the solution is moderately diluted). A buffer contains comparable concentrations of:

  • a weak acid (HA) and
  • its conjugate base (AA^-).

Or equivalently, a weak base and its conjugate acid.

The buffer equilibrium

For an acetic acid / acetate buffer:

CH3COOH(aq)CH3COO(aq)+H(aq)+CH_3COOH_{(aq)} \rightleftharpoons CH_3COO^-_{(aq)} + H^+_{(aq)}

Both species are present in substantial concentration. The equilibrium has "reserves" in both directions.

Adding H+H^+. The conjugate base neutralises it: CH3COO+H+CH3COOHCH_3COO^- + H^+ \rightarrow CH_3COOH. Equilibrium shifts left. The pH drops only slightly.

Adding OHOH^-. The weak acid donates a proton: CH3COOH+OHCH3COO+H2OCH_3COOH + OH^- \rightarrow CH_3COO^- + H_2O. Equilibrium shifts right. The pH rises only slightly.

Both responses are applications of Le Chatelier's principle to the buffer equilibrium.

The Henderson-Hasselbalch equation

For a buffer of weak acid HA with conjugate base AA^-:

pH=pKa+log10([A][HA])pH = pK_a + \log_{10}\left(\frac{[A^-]}{[HA]}\right)

Useful results:

  • When [A]=[HA][A^-] = [HA], log(1)=0\log(1) = 0 and pH = pKapK_a.
  • A buffer is most effective within ±1 pH unit of its pKapK_a.
  • The buffer pH depends on the ratio of [A][A^-] to [HA][HA], so moderate dilution does not change pH much.

Buffer capacity

Illustrative titration curve of 25.0 mL of 0.100 mol/L ethanoic acid titrated with 0.100 mol/L NaOH An owned illustrative pH versus volume of NaOH added titration curve for a weak acid titrated with a strong base. A flat, gently rising buffer region spans roughly 5 to 20 millilitres of NaOH added, centred on the half-equivalence point at 12.5 millilitres where pH equals the pKa of 4.74. A steep rise occurs near the equivalence point at 25 millilitres, where the pH jumps through the phenolphthalein end-point around pH 8.7. pH 13 pH 10 pH 7 pH 4 pH 1 Half-equivalence 12.5 mL, pH = pKa = 4.74 Equivalence point 25.0 mL, pH approx 8.7 Buffer region (flat, resists pH change) 0 10 20 30 40 Volume of 0.100 mol/L NaOH added / mL (illustrative ExamExplained titration)

A buffer has a finite capacity. Once enough acid is added to consume all the conjugate base (or enough base to consume all the weak acid), the buffer fails and the pH changes rapidly. Capacity is maximised when [HA][HA] and [A][A^-] are equal and both large.

The blood buffer system

Blood is buffered between pH 7.35 and 7.45 by the carbonic acid / bicarbonate system:

CO2(g)CO2(aq)+H2OH2CO3(aq)HCO3(aq)+H(aq)+CO_{2(g)} \rightleftharpoons CO_{2(aq)} + H_2O \rightleftharpoons H_2CO_{3(aq)} \rightleftharpoons {HCO_3^-}_{(aq)} + H^+_{(aq)}

The buffer pair is H2CO3H_2CO_3 (pKapK_a ≈ 6.4) and HCO3HCO_3^-. At blood pH 7.4, the Henderson-Hasselbalch ratio [HCO3]/[H2CO3][HCO_3^-] / [H_2CO_3] is about 20:1.

The system is biologically powerful because both ends are open:

  • Lungs regulate CO2CO_2. Hyperventilating expels CO2CO_2, shifting equilibrium left and raising pH.
  • Kidneys regulate HCO3HCO_3^-. They can secrete or retain bicarbonate to compensate over hours to days.

When the buffer fails, the body experiences acidosis (low pH) or alkalosis (high pH), with consequences for enzyme activity, oxygen transport, and ionic balance.

Worked example 2: designing a buffer

Calculate the mole ratio of CH3COOCH_3COO^- to CH3COOHCH_3COOH required to prepare a buffer with pH 5.20. KaK_a of acetic acid is 1.8×1051.8 \times 10^{-5} (pKa=4.74pK_a = 4.74).

Step 1: Apply Henderson-Hasselbalch.

5.20=4.74+log10([A][HA])5.20 = 4.74 + \log_{10}\left(\frac{[A^-]}{[HA]}\right)

log10([A][HA])=0.46\log_{10}\left(\frac{[A^-]}{[HA]}\right) = 0.46

[A][HA]=100.46=2.88\frac{[A^-]}{[HA]} = 10^{0.46} = 2.88

Step 2: Check suitability. The target pH 5.20 is within ±1 pH unit of the pKa (4.74), so acetic acid is a suitable buffer choice. For a buffer at pH 5.20, mix acetate and acetic acid in a 2.88:1 mole ratio. For 1.00 L of buffer, one recipe is 0.10 mol CH3COOHCH_3COOH and 0.288 mol CH3COONaCH_3COONa dissolved in water.

Step 3: Confirm by quick mental check. Above pKa means more conjugate base than acid (ratio > 1). Below pKa means more acid than base (ratio < 1). 5.20 > 4.74, so the ratio should exceed 1. 2.88 > 1. Sensible.

Examples in context

Example 1. Blood gas analysis at Royal Prince Alfred Hospital. Arterial blood gas results from RPA's emergency department report pH, [HCO3][HCO_3^-] and pCO2pCO_2 to within four decimal places. The patient's blood pH is set by the carbonic acid / bicarbonate buffer H2CO3H++HCO3H_2CO_3 \rightleftharpoons H^+ + HCO_3^-, with pKapK_a near 6.1. Plugging values into Henderson-Hasselbalch, pH=6.1+log([HCO3]/[H2CO3])pH = 6.1 + \log([HCO_3^-] / [H_2CO_3]), gives the normal arterial ratio of 20:1, putting blood pH at 7.4. A diabetic patient with ketoacidosis arrives with [HCO3][HCO_3^-] depleted to 12 mmol L1^{-1}, dropping the ratio and the pH. Clinicians treat with intravenous bicarbonate, restoring the ratio and the pH.

Example 2. NSW HSC depth study acetate buffer. A common depth-study assignment is to prepare a 0.10 mol L1^{-1} acetate buffer at pH 4.74 by mixing equal moles of acetic acid and sodium acetate. Students add 1 mL of 0.10 mol L1^{-1} HCl to 50 mL of the buffer and measure the pH change with a calibrated electrode; it falls by less than 0.05 units. They repeat with unbuffered distilled water and watch the pH crash from 7 to about 3. The Henderson-Hasselbalch equation predicts the small change quantitatively, and students must justify the result using Le Chatelier and the conjugate-base reservoir.

Try this

Q1. Identify the two components of an effective buffer and explain why a strong acid and its conjugate base would not buffer effectively. [3 marks]

  • Cue. Weak acid plus conjugate base in comparable concentrations; a strong acid is fully dissociated so there is no reservoir of undissociated acid for the equilibrium to shift back to.

Q2. A buffer is prepared by mixing 0.20 mol CH3COOHCH_3COOH (pKa=4.74pK_a = 4.74) with 0.10 mol CH3COONaCH_3COONa in 1.0 L of water. Calculate the buffer pH. [3 marks]

  • Cue. Apply Henderson-Hasselbalch: pH=4.74+log(0.10/0.20)=4.740.30=4.44pH = 4.74 + \log(0.10 / 0.20) = 4.74 - 0.30 = 4.44.

Q3. A buffer at pH 7.4 is prepared from H2PO4H_2PO_4^- / HPO42HPO_4^{2-} (pKa=7.21pK_a = 7.21). (a) Calculate the ratio [HPO42]/[H2PO4][HPO_4^{2-}] / [H_2PO_4^-]. (b) Write equations to show how the buffer responds to added H3O+H_3O^+ and added OHOH^-. (c) State one biological role of this phosphate buffer. [2+2+1 marks]

  • Cue. (a) log(ratio)=7.47.21=0.19\log(\text{ratio}) = 7.4 - 7.21 = 0.19, so ratio =1.55= 1.55. (b) HPO42+H3O+H2PO4+H2OHPO_4^{2-} + H_3O^+ \rightarrow H_2PO_4^- + H_2O and H2PO4+OHHPO42+H2OH_2PO_4^- + OH^- \rightarrow HPO_4^{2-} + H_2O. (c) Maintains intracellular pH in cytoplasm.

Exam-style practice questions

Practice questions written in the style of NESA exam questions on this dot point, with worked answer explainers. The year tag is the paper they imitate, not the source.

2022 HSC5 marksExplain how a buffer solution made from ethanoic acid (CH₃COOH) and sodium ethanoate (CH₃COONa) resists changes in pH when small amounts of acid or base are added. Use chemical equations to support your answer.
Show worked answer →

A 5 mark answer needs the buffer composition, the equilibrium, and equations showing how the buffer responds to both added acid and added base.

Buffer composition. The buffer contains a weak acid (CH3COOHCH_3COOH) and its conjugate base (CH3COOCH_3COO^-, from CH3COONaCH_3COONa) in comparable concentrations. The equilibrium is:

CH3COOH(aq)CH3COO(aq)+H(aq)+CH_3COOH_{(aq)} \rightleftharpoons CH_3COO^-_{(aq)} + H^+_{(aq)}

Adding a small amount of acid (extra H+H^+). The CH3COOCH_3COO^- acts as a base and accepts the added protons:

CH3COO+H+CH3COOHCH_3COO^- + H^+ \rightarrow CH_3COOH

By Le Chatelier's principle, the equilibrium shifts left, removing most of the added H+H^+. The pH falls only slightly.

Adding a small amount of base (extra OHOH^-). The CH3COOHCH_3COOH donates protons to neutralise the added hydroxide:

CH3COOH+OHCH3COO+H2OCH_3COOH + OH^- \rightarrow CH_3COO^- + H_2O

The equilibrium shifts right, replacing the consumed acid. The pH rises only slightly.

Why it works. Both the weak acid and the conjugate base are present in significant concentration. The buffer has the capacity to neutralise either an added acid or an added base by shifting the equilibrium.

Markers reward (1) explicit identification of the buffer pair, (2) the equilibrium equation, (3) separate equations for the response to acid and to base, (4) referring to Le Chatelier or the shift in equilibrium, (5) a sentence on capacity (buffering only works for small additions).

2019 HSC3 marksDescribe the carbonic acid / bicarbonate buffer system in blood and explain why maintaining a stable blood pH is important.
Show worked answer →

Blood is buffered at pH 7.35 to 7.45 by the carbonic acid / bicarbonate equilibrium:

CO2(aq)+H2O(l)H2CO3(aq)HCO3(aq)+H(aq)+CO_{2(aq)} + H_2O_{(l)} \rightleftharpoons H_2CO_{3(aq)} \rightleftharpoons {HCO_3^-}_{(aq)} + H^+_{(aq)}

The buffer pair is H2CO3H_2CO_3 (weak acid) and HCO3HCO_3^- (conjugate base). When metabolism produces excess H+H^+ (for example, from lactic acid during exercise), HCO3HCO_3^- accepts the proton to form H2CO3H_2CO_3, which dissociates into CO2CO_2 and H2OH_2O. The CO2CO_2 is exhaled by the lungs. When H+H^+ falls, the reverse shift occurs.

Importance. Blood pH outside the 7.35 to 7.45 range causes acidosis (pH below 7.35) or alkalosis (pH above 7.45). These conditions disrupt enzyme function (enzymes are highly pH-sensitive), oxygen transport by haemoglobin, and ionic balance. Severe deviations can be fatal.

Markers reward (1) the equation showing both equilibria, (2) explanation of buffering in both directions, (3) mention of acidosis/alkalosis and a physiological consequence (enzyme function, oxygen transport).

Practice questions

Original practice questions graded from foundation to exam level, each with a full worked solution. Try them before revealing the solution.

foundation2 marksState the two components required for an effective buffer solution and explain, in one sentence, why they must be present in comparable concentrations.
Show worked solution →

A weak acid (HA) and its conjugate base (AA^-), or a weak base and its conjugate acid.

Comparable concentrations are needed so the buffer has "reserves" on both sides of the equilibrium: enough AA^- to neutralise added acid, and enough HA to neutralise added base.

Marking criteria: 1 mark for correctly naming the weak acid / conjugate base pair, 1 mark for the reasoning about comparable concentrations giving capacity in both directions.

foundation3 marksA buffer contains 0.15 mol/L CH3COOHCH_3COOH and 0.15 mol/L CH3COONaCH_3COONa. Without calculating, state the pH relative to the pKapK_a of acetic acid (4.74) and justify your answer using the Henderson-Hasselbalch equation.
Show worked solution →

When [CH3COO]=[CH3COOH][CH_3COO^-] = [CH_3COOH], the ratio [A]/[HA]=1[A^-]/[HA] = 1.

pH=pKa+log10(1)=pKa+0=pKapH = pK_a + \log_{10}(1) = pK_a + 0 = pK_a

So the buffer pH equals the pKapK_a of acetic acid, pH = 4.74.

Marking criteria: 1 mark for recognising the ratio is 1, 1 mark for correctly evaluating log10(1)=0\log_{10}(1) = 0, 1 mark for concluding pH = pKapK_a = 4.74.

core5 marksA buffer is prepared by dissolving 0.410 g of sodium ethanoate (CH3COONaCH_3COONa, M=82.03 g mol1M = 82.03\ \text{g mol}^{-1}) in 250.0 mL of 0.0800 mol/L ethanoic acid solution. Ka(CH3COOH)=1.8×105K_a(CH_3COOH) = 1.8 \times 10^{-5}. Calculate the pH of the buffer, to 2 decimal places.
Show worked solution →

Step 1: moles of ethanoic acid (the weak acid, HA).

n(CH3COOH)=c×V=0.0800 mol L1×0.2500 L=0.02000 moln(CH_3COOH) = c \times V = 0.0800\ \text{mol L}^{-1} \times 0.2500\ \text{L} = 0.02000\ \text{mol}

Step 2: moles of sodium ethanoate (source of the conjugate base, AA^-).

n(CH3COONa)=mM=0.410 g82.03 g mol1=0.004998 mol0.00500 moln(CH_3COONa) = \frac{m}{M} = \frac{0.410\ \text{g}}{82.03\ \text{g mol}^{-1}} = 0.004998\ \text{mol} \approx 0.00500\ \text{mol}

Since both species share the same 250.0 mL volume, the ratio of moles equals the ratio of concentrations, so the volume cancels in the Henderson-Hasselbalch ratio.

Step 3: pKapK_a.

pKa=log10(1.8×105)=4.74pK_a = -\log_{10}(1.8 \times 10^{-5}) = 4.74

Step 4: apply Henderson-Hasselbalch.

pH=pKa+log10(n(A)n(HA))=4.74+log10(0.005000.02000)pH = pK_a + \log_{10}\left(\frac{n(A^-)}{n(HA)}\right) = 4.74 + \log_{10}\left(\frac{0.00500}{0.02000}\right)

pH=4.74+log10(0.250)=4.74+(0.602)=4.14pH = 4.74 + \log_{10}(0.250) = 4.74 + (-0.602) = 4.14

Step 5: round to 2 decimal places (matching the precision implied by the data).

pH=4.14pH = 4.14

Marking criteria: 1 mark for correct moles of ethanoic acid, 1 mark for correct moles of sodium ethanoate, 1 mark for correct pKapK_a, 1 mark for correctly substituting into Henderson-Hasselbalch, 1 mark for the final pH to appropriate precision. Note the pH is below the pKapK_a because there is more acid than conjugate base present (ratio < 1).

core5 marksThe titration curve below is an owned illustrative curve for 25.0 mL of 0.100 mol/L CH3COOHCH_3COOH titrated with 0.100 mol/L NaOH. A flat, gently sloping region is marked between roughly 5 mL and 20 mL of NaOH added, straddling the half-equivalence point at 12.5 mL. (a) Explain, with reference to the buffer equilibrium, why the curve is so flat in this marked region. (b) State the pH at the half-equivalence point in terms of the acid's pKapK_a, and justify using Henderson-Hasselbalch.
Show worked solution →

(a) Why the curve is flat. In the marked region, the flask contains a mixture of unreacted CH3COOHCH_3COOH and the CH3COOCH_3COO^- produced by the NaOH added so far, i.e. a buffer. As more NaOH is added, CH3COOH+OHCH3COO+H2OCH_3COOH + OH^- \rightarrow CH_3COO^- + H_2O consumes the acid and produces more conjugate base, but because both species remain present in comparable amounts throughout this region, the equilibrium continuously replenishes the buffering capacity and the pH rises only gradually. Only once the acid is nearly used up (near the equivalence point at 25 mL) does one component run out and the pH rise steeply.

(b) pH at half-equivalence. At the half-equivalence point (12.5 mL added), exactly half of the original CH3COOHCH_3COOH has been converted to CH3COOCH_3COO^-, so n(CH3COO)=n(CH3COOH)n(CH_3COO^-) = n(CH_3COOH) and the ratio [A]/[HA]=1[A^-]/[HA] = 1.

pH=pKa+log10(1)=pKapH = pK_a + \log_{10}(1) = pK_a

So the pH at half-equivalence equals the pKapK_a of acetic acid, 4.74. This is why the half-equivalence point is used experimentally to determine an unknown acid's pKapK_a directly from a titration curve.

Marking criteria: (a) 1 mark for identifying the mixture as a buffer, 1 mark for the neutralisation equation, 1 mark for explaining that comparable concentrations of both species maintain buffering across the region. (b) 1 mark for identifying the ratio is 1 at half-equivalence, 1 mark for concluding pH = pKapK_a.

core4 marksA buffer of NH3NH_3 / NH4+NH_4^+ has Kb(NH3)=1.8×105K_b(NH_3) = 1.8 \times 10^{-5}. Calculate the pKapK_a of the conjugate acid NH4+NH_4^+, then state the pH of a buffer in which [NH3]=[NH4+][NH_3] = [NH_4^+].
Show worked solution →

Step 1: find pKbpK_b.

pKb=log10(1.8×105)=4.74pK_b = -\log_{10}(1.8 \times 10^{-5}) = 4.74

Step 2: convert to pKapK_a of the conjugate acid using pKa+pKb=14pK_a + pK_b = 14 (at 25 degrees C).

pKa(NH4+)=144.74=9.26pK_a(NH_4^+) = 14 - 4.74 = 9.26

Step 3: apply Henderson-Hasselbalch with NH4+NH_4^+ as HA and NH3NH_3 as AA^-.

Since [NH3]=[NH4+][NH_3] = [NH_4^+], the ratio is 1 and log10(1)=0\log_{10}(1) = 0.

pH=pKa+0=9.26pH = pK_a + 0 = 9.26

Marking criteria: 1 mark for correct pKbpK_b, 1 mark for correctly converting to pKapK_a using the 14 relationship, 1 mark for identifying the ratio is 1, 1 mark for the final pH = 9.26.

exam7 marksAssess the effectiveness of the carbonic acid / bicarbonate buffer system, compared with a single-component acid-neutralising system (such as directly excreting acid), in maintaining a stable blood pH during vigorous exercise.
Show worked solution →

This is a 7-mark ASSESS: markers reward a judgement backed by chemistry, not just a description of the buffer.

Band 6 PLAN.

  • Thesis: the carbonic acid / bicarbonate buffer is far more effective than a single-component excretion system because it provides an immediate, reversible chemical response at the moment lactic acid is produced, backed up by two independent physiological control points (lungs and kidneys), whereas relying solely on excretion is too slow to prevent a dangerous pH swing during exercise.
  • Mechanism: during vigorous exercise, anaerobic respiration produces lactic acid, releasing H+H^+. The bicarbonate buffer immediately neutralises it: HCO3+H+H2CO3CO2+H2OHCO_3^- + H^+ \rightarrow H_2CO_3 \rightarrow CO_{2} + H_2O, converting a strong-acid threat into extra CO2CO_2.
  • Fast compensation: the increased CO2CO_2 is detected by chemoreceptors, triggering faster/deeper breathing (hyperventilation), which exhales CO2CO_2 and shifts the equilibrium further to the right, continuously regenerating buffering capacity within seconds.
  • Slow compensation: over hours, the kidneys can adjust HCO3HCO_3^- reabsorption to restore the buffer's reserve ready for the next exertion.
  • Contrast: a hypothetical single-component system that relies only on excreting excess acid (e.g. via the kidneys alone, with no chemical buffer) would leave H+H^+ free in the blood for minutes to hours before the kidneys respond, during which enzyme function and haemoglobin's oxygen affinity would be significantly disrupted; the buffer's near-instant chemical response prevents this.
  • Judgement: the two-tier design (chemical equilibrium acting in milliseconds, respiratory compensation acting in seconds, renal compensation acting over hours) makes the carbonic acid / bicarbonate system far more effective than any single-component approach for a tissue that cannot tolerate even brief large pH swings.

Model paragraph (excerpt). The carbonic acid / bicarbonate buffer is markedly more effective than a hypothetical single-component excretion system because it intercepts excess H+H^+ chemically, within the equilibrium HCO3+H+H2CO3CO2+H2OHCO_3^- + H^+ \rightleftharpoons H_2CO_3 \rightleftharpoons CO_2 + H_2O, at the instant lactic acid is produced during vigorous exercise. This immediate buffering prevents the sharp pH drop that would otherwise impair enzyme activity and haemoglobin's oxygen-binding affinity. The lungs then reinforce the chemical response within seconds by exhaling the extra CO2CO_2, continually shifting the equilibrium right and regenerating the buffer's capacity for further exertion, a feedback loop that a single-component excretory system, acting only over minutes to hours through the kidneys, cannot match.

Marker's note: top-band answers (1) give the buffer equation showing the direction of shift under exercise-induced acid load, (2) explicitly name BOTH the fast (respiratory) and slow (renal) compensation mechanisms, (3) give a concrete physiological consequence of buffer failure (enzyme function, oxygen affinity), and (4) end with an explicit comparative judgement, not a neutral summary of the buffer alone.

ExamExplained